About N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide
N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 6465956) has the molecular formula C13H12N4O2
and a molecular weight of 256.26 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 6465956 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C13H12N4O2/c1-7-12(8(2)19-17-7)13(18)15-10-3-4-11-9(5-10)6-14-16-11/h3-6H,1-2H3,(H,14,16)(H,15,18) |
| InChIKey | XKEHUVUDXINMOI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (CID 6465956) is N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide is Cc1noc(C)c1C(=O)Nc1ccc2[nH]ncc2c1.
What is the InChIKey of N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The InChIKey is XKEHUVUDXINMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2/c1-7-12(8(2)19-17-7)13(18)15-10-3-4-11-9(5-10)6-14-16-11/h3-6H,1-2H3,(H,14,16)(H,15,18).
What are the key properties of N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide has a molecular weight of 256.26 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-5-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 6465956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).