About (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone
(4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone (PubChem CID 646604) has the molecular formula C11H12ClNO2
and a molecular weight of 225.68 g/mol. Its IUPAC name is (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone |
| PubChem CID | 646604 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCOC1 |
| InChI | InChI=1S/C11H12ClNO2/c12-10-4-2-9(3-5-10)11(14)13-6-1-7-15-8-13/h2-5H,1,6-8H2 |
| InChIKey | OJOUCZPKSSJXIU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone?
The IUPAC name of (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone (CID 646604) is (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone.
What is the SMILES notation for (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone?
The canonical SMILES for (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone is O=C(c1ccc(Cl)cc1)N1CCCOC1.
What is the InChIKey of (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone?
The InChIKey is OJOUCZPKSSJXIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c12-10-4-2-9(3-5-10)11(14)13-6-1-7-15-8-13/h2-5H,1,6-8H2.
What are the key properties of (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone?
(4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone has a molecular weight of 225.68 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-(1,3-oxazinan-3-yl)methanone is sourced from PubChem (CID 646604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).