C17H18OS — CID 64660488
1-[3-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]ethanone (PubChem CID 64660488) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 1-[3-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]ethanone.
| Compound Name | 1-[3-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]ethanone |
|---|---|
| PubChem CID | 64660488 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-[3-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(SCc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C17H18OS/c1-12-7-8-13(2)16(9-12)11-19-17-6-4-5-15(10-17)14(3)18/h4-10H,11H2,1-3H3 |
| InChIKey | VXZOFNSNMMTDJQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |