About (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate
(4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate (PubChem CID 646634) has the molecular formula C10H9N3O3
and a molecular weight of 219.20 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate.
Molecular Properties
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate |
| PubChem CID | 646634 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate |
| SMILES | CC(=O)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C10H9N3O3/c1-7(14)16-6-13-10(15)8-4-2-3-5-9(8)11-12-13/h2-5H,6H2,1H3 |
| InChIKey | GQHJWXXULIZFSC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate?
The IUPAC name of (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate (CID 646634) is (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate.
What is the SMILES notation for (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate?
The canonical SMILES for (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate is CC(=O)OCn1nnc2ccccc2c1=O.
What is the InChIKey of (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate?
The InChIKey is GQHJWXXULIZFSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c1-7(14)16-6-13-10(15)8-4-2-3-5-9(8)11-12-13/h2-5H,6H2,1H3.
What are the key properties of (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate?
(4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate has a molecular weight of 219.20 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1,2,3-benzotriazin-3-yl)methyl acetate is sourced from PubChem (CID 646634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).