C12H23NO2 — CID 64663875
2-(1-amino-2-tert-butylcyclohexyl)acetic acid (PubChem CID 64663875) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(1-amino-2-tert-butylcyclohexyl)acetic acid.
| Compound Name | 2-(1-amino-2-tert-butylcyclohexyl)acetic acid |
|---|---|
| PubChem CID | 64663875 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-(1-amino-2-tert-butylcyclohexyl)acetic acid |
| SMILES | CC(C)(C)C1CCCCC1(N)CC(=O)O |
| InChI | InChI=1S/C12H23NO2/c1-11(2,3)9-6-4-5-7-12(9,13)8-10(14)15/h9H,4-8,13H2,1-3H3,(H,14,15) |
| InChIKey | XSWWIVKDBQVAMI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |