C15H25NS — CID 64664023
N-[1-[3-(2-methylpropylsulfanyl)phenyl]ethyl]propan-1-amine (PubChem CID 64664023) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is N-[1-[3-(2-methylpropylsulfanyl)phenyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[3-(2-methylpropylsulfanyl)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64664023 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-[1-[3-(2-methylpropylsulfanyl)phenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cccc(SCC(C)C)c1 |
| InChI | InChI=1S/C15H25NS/c1-5-9-16-13(4)14-7-6-8-15(10-14)17-11-12(2)3/h6-8,10,12-13,16H,5,9,11H2,1-4H3 |
| InChIKey | WMPONWYESXSTEN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |