2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride

C11H12ClNO5S — CID 64664060

IUPAC2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride
SMILESCOc1cc(OC)cc(C2CC(=O)N2S(=O)(=O)Cl)c1
InChIInChI=1S/C11H12ClNO5S/c1-17-8-3-7(4-9(5-8)18-2)10-6-11(14)13(10)19(12,15)16/h3-5,10H,6H2,1-2H3
InChIKeyIHJHLDXMHLNQLE-UHFFFAOYSA-N
MW305.74 g/mol
LogP1.46
Rot. Bonds4

About 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride

2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride (PubChem CID 64664060) has the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride.

Molecular Properties

Compound Name2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride
PubChem CID64664060
Molecular FormulaC11H12ClNO5S
Molecular Weight305.74 g/mol
Exact Mass305.01
IUPAC Name2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride
SMILESCOc1cc(OC)cc(C2CC(=O)N2S(=O)(=O)Cl)c1
InChIInChI=1S/C11H12ClNO5S/c1-17-8-3-7(4-9(5-8)18-2)10-6-11(14)13(10)19(12,15)16/h3-5,10H,6H2,1-2H3
InChIKeyIHJHLDXMHLNQLE-UHFFFAOYSA-N
XLogP1.46
TPSA72.91 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.74
LogP ≤ 51.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride?
The IUPAC name of 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride (CID 64664060) is 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride.
What is the SMILES notation for 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride?
The canonical SMILES for 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride is COc1cc(OC)cc(C2CC(=O)N2S(=O)(=O)Cl)c1.
What is the InChIKey of 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride?
The InChIKey is IHJHLDXMHLNQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO5S/c1-17-8-3-7(4-9(5-8)18-2)10-6-11(14)13(10)19(12,15)16/h3-5,10H,6H2,1-2H3.
What are the key properties of 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride?
2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride has a molecular weight of 305.74 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethoxyphenyl)-4-oxoazetidine-1-sulfonyl chloride is sourced from PubChem (CID 64664060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).