About 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride
2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride (PubChem CID 64665342) has the molecular formula C9H6ClF2NO3S
and a molecular weight of 281.67 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride |
| PubChem CID | 64665342 |
| Molecular Formula | C9H6ClF2NO3S |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride |
| SMILES | O=C1CC(c2ccc(F)c(F)c2)N1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H6ClF2NO3S/c10-17(15,16)13-8(4-9(13)14)5-1-2-6(11)7(12)3-5/h1-3,8H,4H2 |
| InChIKey | JAWKIISQEQJWCM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride?
The IUPAC name of 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride (CID 64665342) is 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride.
What is the SMILES notation for 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride?
The canonical SMILES for 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride is O=C1CC(c2ccc(F)c(F)c2)N1S(=O)(=O)Cl.
What is the InChIKey of 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride?
The InChIKey is JAWKIISQEQJWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClF2NO3S/c10-17(15,16)13-8(4-9(13)14)5-1-2-6(11)7(12)3-5/h1-3,8H,4H2.
What are the key properties of 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride?
2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride has a molecular weight of 281.67 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-4-oxoazetidine-1-sulfonyl chloride is sourced from PubChem (CID 64665342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).