C18H26N2OS — CID 6466553
(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 6466553) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is (5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-(4-prop-2-enylpiperazin-1-yl)methanone.
| Compound Name | (5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-(4-prop-2-enylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 6466553 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)c2cc3c(s2)CCC(CC)C3)CC1 |
| InChI | InChI=1S/C18H26N2OS/c1-3-7-19-8-10-20(11-9-19)18(21)17-13-15-12-14(4-2)5-6-16(15)22-17/h3,13-14H,1,4-12H2,2H3 |
| InChIKey | DCAZMIOQKYPICU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|