About 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one
8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one (PubChem CID 64665977) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one.
Molecular Properties
| Compound Name | 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one |
| PubChem CID | 64665977 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one |
| SMILES | O=C1CC2(CCCS(=O)(=O)C2)N1 |
| InChI | InChI=1S/C7H11NO3S/c9-6-4-7(8-6)2-1-3-12(10,11)5-7/h1-5H2,(H,8,9) |
| InChIKey | AIBIRRWMLHOYTA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one?
The IUPAC name of 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one (CID 64665977) is 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one.
What is the SMILES notation for 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one?
The canonical SMILES for 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one is O=C1CC2(CCCS(=O)(=O)C2)N1.
What is the InChIKey of 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one?
The InChIKey is AIBIRRWMLHOYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c9-6-4-7(8-6)2-1-3-12(10,11)5-7/h1-5H2,(H,8,9).
What are the key properties of 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one?
8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one has a molecular weight of 189.24 g/mol, XLogP of -0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dioxo-8λ6-thia-1-azaspiro[3.5]nonan-2-one is sourced from PubChem (CID 64665977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).