C9H13ClN2O — CID 64666699
3-(2-amino-5-chloro-3-pyridinyl)-2-methylpropan-1-ol (PubChem CID 64666699) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 3-(2-amino-5-chloro-3-pyridinyl)-2-methylpropan-1-ol.
| Compound Name | 3-(2-amino-5-chloro-3-pyridinyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 64666699 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3-(2-amino-5-chloro-3-pyridinyl)-2-methylpropan-1-ol |
| SMILES | CC(CO)Cc1cc(Cl)cnc1N |
| InChI | InChI=1S/C9H13ClN2O/c1-6(5-13)2-7-3-8(10)4-12-9(7)11/h3-4,6,13H,2,5H2,1H3,(H2,11,12) |
| InChIKey | RMNRTCHDHWVBSV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |