C12H16N4O2 — CID 64667254
2-amino-N-(1-methyl-6-oxopiperidin-3-yl)pyridine-4-carboxamide (PubChem CID 64667254) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-amino-N-(1-methyl-6-oxopiperidin-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-amino-N-(1-methyl-6-oxopiperidin-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 64667254 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-amino-N-(1-methyl-6-oxopiperidin-3-yl)pyridine-4-carboxamide |
| SMILES | CN1CC(NC(=O)c2ccnc(N)c2)CCC1=O |
| InChI | InChI=1S/C12H16N4O2/c1-16-7-9(2-3-11(16)17)15-12(18)8-4-5-14-10(13)6-8/h4-6,9H,2-3,7H2,1H3,(H2,13,14)(H,15,18) |
| InChIKey | LZVITKAPMZQNID-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |