C17H21N3O — CID 64667286
1-cyclopropyl-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 64667286) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-cyclopropyl-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | 1-cyclopropyl-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 64667286 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-cyclopropyl-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | CC(N)(c1nc(C2CCCc3ccccc32)no1)C1CC1 |
| InChI | InChI=1S/C17H21N3O/c1-17(18,12-9-10-12)16-19-15(20-21-16)14-8-4-6-11-5-2-3-7-13(11)14/h2-3,5,7,12,14H,4,6,8-10,18H2,1H3 |
| InChIKey | YFKBNKGSSZSVHH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |