C14H15NO2 — CID 6466784
N-(furan-2-ylmethyl)-2-(3-methylphenyl)acetamide (PubChem CID 6466784) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(3-methylphenyl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 6466784 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C14H15NO2/c1-11-4-2-5-12(8-11)9-14(16)15-10-13-6-3-7-17-13/h2-8H,9-10H2,1H3,(H,15,16) |
| InChIKey | PRRUVXDXXGKPLS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |