C14H19NO4 — CID 64668381
ethyl 2-(1,3-benzodioxol-5-ylmethylamino)butanoate (PubChem CID 64668381) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 2-(1,3-benzodioxol-5-ylmethylamino)butanoate.
| Compound Name | ethyl 2-(1,3-benzodioxol-5-ylmethylamino)butanoate |
|---|---|
| PubChem CID | 64668381 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl 2-(1,3-benzodioxol-5-ylmethylamino)butanoate |
| SMILES | CCOC(=O)C(CC)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19NO4/c1-3-11(14(16)17-4-2)15-8-10-5-6-12-13(7-10)19-9-18-12/h5-7,11,15H,3-4,8-9H2,1-2H3 |
| InChIKey | FRGOWMWZBBJVRM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |