C13H15Cl3N2O2S — CID 6466850
2-(2,4,5-trichlorophenyl)sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 6466850) has the molecular formula C13H15Cl3N2O2S and a molecular weight of 369.70 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenyl)sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(2,4,5-trichlorophenyl)sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 6466850 |
| Molecular Formula | C13H15Cl3N2O2S |
| Molecular Weight | 369.70 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2-(2,4,5-trichlorophenyl)sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | O=S(=O)(c1cc(Cl)c(Cl)cc1Cl)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C13H15Cl3N2O2S/c14-10-6-12(16)13(7-11(10)15)21(19,20)18-5-4-17-3-1-2-9(17)8-18/h6-7,9H,1-5,8H2 |
| InChIKey | RAYHZJDAQXPXQL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|