C16H27IN2O2 — CID 646692
3-(4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propyl-trimethylazanium iodide (PubChem CID 646692) has the molecular formula C16H27IN2O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 3-(4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propyl-trimethylazanium iodide.
| Compound Name | 3-(4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 646692 |
| Molecular Formula | C16H27IN2O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-(4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propyl-trimethylazanium iodide |
| SMILES | CC1=CC(C)C2C(=O)N(CCC[N+](C)(C)C)C(=O)C2C1.[I-] |
| InChI | InChI=1S/C16H27N2O2.HI/c1-11-9-12(2)14-13(10-11)15(19)17(16(14)20)7-6-8-18(3,4)5;/h9,12-14H,6-8,10H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | YZRSOVHANOJWRH-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|