C11H19N3O4 — CID 64669836
2-methyl-3-[(1-methyl-6-oxopiperidin-3-yl)carbamoylamino]propanoic acid (PubChem CID 64669836) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-methyl-3-[(1-methyl-6-oxopiperidin-3-yl)carbamoylamino]propanoic acid.
| Compound Name | 2-methyl-3-[(1-methyl-6-oxopiperidin-3-yl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 64669836 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-methyl-3-[(1-methyl-6-oxopiperidin-3-yl)carbamoylamino]propanoic acid |
| SMILES | CC(CNC(=O)NC1CCC(=O)N(C)C1)C(=O)O |
| InChI | InChI=1S/C11H19N3O4/c1-7(10(16)17)5-12-11(18)13-8-3-4-9(15)14(2)6-8/h7-8H,3-6H2,1-2H3,(H,16,17)(H2,12,13,18) |
| InChIKey | KRGGKLLXHYBRME-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |