C12H19N5O3S — CID 64669851
2-(ethylamino)-N-(1-methyl-6-oxopiperidin-3-yl)pyrimidine-5-sulfonamide (PubChem CID 64669851) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(ethylamino)-N-(1-methyl-6-oxopiperidin-3-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-(ethylamino)-N-(1-methyl-6-oxopiperidin-3-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 64669851 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(ethylamino)-N-(1-methyl-6-oxopiperidin-3-yl)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)NC2CCC(=O)N(C)C2)cn1 |
| InChI | InChI=1S/C12H19N5O3S/c1-3-13-12-14-6-10(7-15-12)21(19,20)16-9-4-5-11(18)17(2)8-9/h6-7,9,16H,3-5,8H2,1-2H3,(H,13,14,15) |
| InChIKey | SFILDDXJKIDFHS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |