C18H15N3O — CID 646706
2-amino-4-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile (PubChem CID 646706) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-amino-4-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 646706 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-amino-4-(4-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(-c2ccc(O)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C18H15N3O/c19-9-15-13-3-1-2-4-14(13)17(16(10-20)18(15)21)11-5-7-12(22)8-6-11/h5-8,22H,1-4,21H2 |
| InChIKey | QSNQOVVRCSWLNX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|