About 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine
1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine (PubChem CID 64671048) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine |
| PubChem CID | 64671048 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine |
| SMILES | COc1cc2nc(CC3(N)CCCCC3)[nH]c2cc1OC |
| InChI | InChI=1S/C16H23N3O2/c1-20-13-8-11-12(9-14(13)21-2)19-15(18-11)10-16(17)6-4-3-5-7-16/h8-9H,3-7,10,17H2,1-2H3,(H,18,19) |
| InChIKey | NFWNHEUHEWDTDM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine?
The IUPAC name of 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine (CID 64671048) is 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine.
What is the SMILES notation for 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine?
The canonical SMILES for 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine is COc1cc2nc(CC3(N)CCCCC3)[nH]c2cc1OC.
What is the InChIKey of 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine?
The InChIKey is NFWNHEUHEWDTDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-20-13-8-11-12(9-14(13)21-2)19-15(18-11)10-16(17)6-4-3-5-7-16/h8-9H,3-7,10,17H2,1-2H3,(H,18,19).
What are the key properties of 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine?
1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine has a molecular weight of 289.38 g/mol, XLogP of 2.78, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5,6-dimethoxy-1H-benzimidazol-2-yl)methyl]cyclohexan-1-amine is sourced from PubChem (CID 64671048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).