About 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid
3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 64671370) has the molecular formula C11H22N2O5S
and a molecular weight of 294.37 g/mol. Its IUPAC name is 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid |
| PubChem CID | 64671370 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC1CN(S(=O)(=O)NC(C)(C)CC(=O)O)CC(C)O1 |
| InChI | InChI=1S/C11H22N2O5S/c1-8-6-13(7-9(2)18-8)19(16,17)12-11(3,4)5-10(14)15/h8-9,12H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | IINAVFGQLSHQII-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
The IUPAC name of 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid (CID 64671370) is 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid.
What is the SMILES notation for 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
The canonical SMILES for 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid is CC1CN(S(=O)(=O)NC(C)(C)CC(=O)O)CC(C)O1.
What is the InChIKey of 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
The InChIKey is IINAVFGQLSHQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O5S/c1-8-6-13(7-9(2)18-8)19(16,17)12-11(3,4)5-10(14)15/h8-9,12H,5-7H2,1-4H3,(H,14,15).
What are the key properties of 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid has a molecular weight of 294.37 g/mol, XLogP of 0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid is sourced from PubChem (CID 64671370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).