C13H23NO4S — CID 64673131
2-[1-(cyclohexylsulfonylamino)cyclopentyl]acetic acid (PubChem CID 64673131) has the molecular formula C13H23NO4S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[1-(cyclohexylsulfonylamino)cyclopentyl]acetic acid.
| Compound Name | 2-[1-(cyclohexylsulfonylamino)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 64673131 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[1-(cyclohexylsulfonylamino)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(NS(=O)(=O)C2CCCCC2)CCCC1 |
| InChI | InChI=1S/C13H23NO4S/c15-12(16)10-13(8-4-5-9-13)14-19(17,18)11-6-2-1-3-7-11/h11,14H,1-10H2,(H,15,16) |
| InChIKey | CFYBFJXOSKOGGX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |