C15H23NO2S — CID 64673627
2-propan-2-ylsulfonyl-N-propyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 64673627) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-propan-2-ylsulfonyl-N-propyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-propan-2-ylsulfonyl-N-propyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 64673627 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-propan-2-ylsulfonyl-N-propyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCNC1c2ccccc2CC1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C15H23NO2S/c1-4-9-16-15-13-8-6-5-7-12(13)10-14(15)19(17,18)11(2)3/h5-8,11,14-16H,4,9-10H2,1-3H3 |
| InChIKey | YNQGFBUJGJLGHU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |