C15H21F2NO2S — CID 64673745
2-(2,5-difluorophenyl)sulfonyl-N,4,4-trimethylcyclohexan-1-amine (PubChem CID 64673745) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfonyl-N,4,4-trimethylcyclohexan-1-amine.
| Compound Name | 2-(2,5-difluorophenyl)sulfonyl-N,4,4-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64673745 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfonyl-N,4,4-trimethylcyclohexan-1-amine |
| SMILES | CNC1CCC(C)(C)CC1S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H21F2NO2S/c1-15(2)7-6-12(18-3)14(9-15)21(19,20)13-8-10(16)4-5-11(13)17/h4-5,8,12,14,18H,6-7,9H2,1-3H3 |
| InChIKey | FEJOUGBENWGPOY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |