About methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate
methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate (PubChem CID 64674370) has the molecular formula C12H25NO4S
and a molecular weight of 279.40 g/mol. Its IUPAC name is methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate |
| PubChem CID | 64674370 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate |
| SMILES | CCNC(CS(=O)(=O)CCC(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C12H25NO4S/c1-6-13-10(12(2,3)4)9-18(15,16)8-7-11(14)17-5/h10,13H,6-9H2,1-5H3 |
| InChIKey | SHKXVLCFGXBMGA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate?
The IUPAC name of methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate (CID 64674370) is methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate.
What is the SMILES notation for methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate?
The canonical SMILES for methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate is CCNC(CS(=O)(=O)CCC(=O)OC)C(C)(C)C.
What is the InChIKey of methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate?
The InChIKey is SHKXVLCFGXBMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO4S/c1-6-13-10(12(2,3)4)9-18(15,16)8-7-11(14)17-5/h10,13H,6-9H2,1-5H3.
What are the key properties of methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate?
methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate has a molecular weight of 279.40 g/mol, XLogP of 0.99, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(ethylamino)-3,3-dimethylbutyl]sulfonylpropanoate is sourced from PubChem (CID 64674370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).