C16H31NO2S — CID 64674406
2-cyclohexylsulfonyl-N,4-diethylcyclohexan-1-amine (PubChem CID 64674406) has the molecular formula C16H31NO2S and a molecular weight of 301.50 g/mol. Its IUPAC name is 2-cyclohexylsulfonyl-N,4-diethylcyclohexan-1-amine.
| Compound Name | 2-cyclohexylsulfonyl-N,4-diethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64674406 |
| Molecular Formula | C16H31NO2S |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | 2-cyclohexylsulfonyl-N,4-diethylcyclohexan-1-amine |
| SMILES | CCNC1CCC(CC)CC1S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H31NO2S/c1-3-13-10-11-15(17-4-2)16(12-13)20(18,19)14-8-6-5-7-9-14/h13-17H,3-12H2,1-2H3 |
| InChIKey | RVTOYVGIWWIGDA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |