C15H23NO3S — CID 64675196
2-cyclohexylsulfonyl-1-(4-methoxyphenyl)ethanamine (PubChem CID 64675196) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-cyclohexylsulfonyl-1-(4-methoxyphenyl)ethanamine.
| Compound Name | 2-cyclohexylsulfonyl-1-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 64675196 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-cyclohexylsulfonyl-1-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(N)CS(=O)(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H23NO3S/c1-19-13-9-7-12(8-10-13)15(16)11-20(17,18)14-5-3-2-4-6-14/h7-10,14-15H,2-6,11,16H2,1H3 |
| InChIKey | SGBQCNHRNUIUJL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |