About 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline
2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline (PubChem CID 646753) has the molecular formula C17H15N3
and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline.
Molecular Properties
| Compound Name | 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline |
| PubChem CID | 646753 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline |
| SMILES | Cc1cc2n(n1)C(c1ccccc1)Nc1ccccc1-2 |
| InChI | InChI=1S/C17H15N3/c1-12-11-16-14-9-5-6-10-15(14)18-17(20(16)19-12)13-7-3-2-4-8-13/h2-11,17-18H,1H3 |
| InChIKey | UOPUWDHABWQXES-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline?
The IUPAC name of 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline (CID 646753) is 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline.
What is the SMILES notation for 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline?
The canonical SMILES for 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline is Cc1cc2n(n1)C(c1ccccc1)Nc1ccccc1-2.
What is the InChIKey of 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline?
The InChIKey is UOPUWDHABWQXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3/c1-12-11-16-14-9-5-6-10-15(14)18-17(20(16)19-12)13-7-3-2-4-8-13/h2-11,17-18H,1H3.
What are the key properties of 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline?
2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline has a molecular weight of 261.33 g/mol, XLogP of 3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-phenyl-5,6-dihydropyrazolo[1,5-c]quinazoline is sourced from PubChem (CID 646753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).