C13H13N3OS2 — CID 646758
4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 646758) has the molecular formula C13H13N3OS2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 646758 |
| Molecular Formula | C13H13N3OS2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CC1=C(SC(=N1)C)C2=CSC(=N2)NCC3=CC=CO3 |
| InChI | InChI=1S/C13H13N3OS2/c1-8-12(19-9(2)15-8)11-7-18-13(16-11)14-6-10-4-3-5-17-10/h3-5,7H,6H2,1-2H3,(H,14,16) |
| InChIKey | RWSCDFSCSDPGCF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 308 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazole_amine_C(3)', 'substructure': 'N/A'} |
|---|