C15H25NO4S — CID 64675860
N-ethyl-1-(2-methoxyphenyl)-2-(3-methoxypropylsulfonyl)ethanamine (PubChem CID 64675860) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-ethyl-1-(2-methoxyphenyl)-2-(3-methoxypropylsulfonyl)ethanamine.
| Compound Name | N-ethyl-1-(2-methoxyphenyl)-2-(3-methoxypropylsulfonyl)ethanamine |
|---|---|
| PubChem CID | 64675860 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-ethyl-1-(2-methoxyphenyl)-2-(3-methoxypropylsulfonyl)ethanamine |
| SMILES | CCNC(CS(=O)(=O)CCCOC)c1ccccc1OC |
| InChI | InChI=1S/C15H25NO4S/c1-4-16-14(12-21(17,18)11-7-10-19-2)13-8-5-6-9-15(13)20-3/h5-6,8-9,14,16H,4,7,10-12H2,1-3H3 |
| InChIKey | PZTGOKFIYLTBQM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|