C15H17N3O3S2 — CID 6467619
methyl 5-ethyl-2-[[2-(4-methylpyrimidin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 6467619) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is methyl 5-ethyl-2-[[2-(4-methylpyrimidin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-[[2-(4-methylpyrimidin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6467619 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | methyl 5-ethyl-2-[[2-(4-methylpyrimidin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=O)CSc2nccc(C)n2)s1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-4-10-7-11(14(20)21-3)13(23-10)18-12(19)8-22-15-16-6-5-9(2)17-15/h5-7H,4,8H2,1-3H3,(H,18,19) |
| InChIKey | OAOXLBVQNZEHSB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |