C12H22N2O3 — CID 64676761
1-[(3-amino-3-methylbutanoyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 64676761) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-[(3-amino-3-methylbutanoyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(3-amino-3-methylbutanoyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 64676761 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 1-[(3-amino-3-methylbutanoyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(N)CC(=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C12H22N2O3/c1-11(2,13)8-9(15)14-12(10(16)17)6-4-3-5-7-12/h3-8,13H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | PJKWQRLGXBSGNC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |