C19H30N2O4 — CID 6467745
(4-methyl-1,4-diazepan-1-yl)-(3,4,5-triethoxyphenyl)methanone (PubChem CID 6467745) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 6467745 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCCN(C)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H30N2O4/c1-5-23-16-13-15(14-17(24-6-2)18(16)25-7-3)19(22)21-10-8-9-20(4)11-12-21/h13-14H,5-12H2,1-4H3 |
| InChIKey | ZWFOSEGRYBWWKC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |