C11H14N4O2S — CID 6467759
1,3-dimethyl-N-(pyridin-3-ylmethyl)pyrazole-4-sulfonamide (PubChem CID 6467759) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 1,3-dimethyl-N-(pyridin-3-ylmethyl)pyrazole-4-sulfonamide.
| Compound Name | 1,3-dimethyl-N-(pyridin-3-ylmethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 6467759 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1,3-dimethyl-N-(pyridin-3-ylmethyl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)NCc1cccnc1 |
| InChI | InChI=1S/C11H14N4O2S/c1-9-11(8-15(2)14-9)18(16,17)13-7-10-4-3-5-12-6-10/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | ISFNDJSEBBCRFD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |