methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate

C11H12N2O3 — CID 646778

IUPACmethyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1oc2nc(C)cc(C)c2c1N
InChIInChI=1S/C11H12N2O3/c1-5-4-6(2)13-10-7(5)8(12)9(16-10)11(14)15-3/h4H,12H2,1-3H3
InChIKeyYLWSLDLOSJQFTR-UHFFFAOYSA-N
MW220.23 g/mol
LogP1.81
Rot. Bonds1

About methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate

methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate (PubChem CID 646778) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate
PubChem CID646778
Molecular FormulaC11H12N2O3
Molecular Weight220.23 g/mol
Exact Mass220.08
IUPAC Namemethyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1oc2nc(C)cc(C)c2c1N
InChIInChI=1S/C11H12N2O3/c1-5-4-6(2)13-10-7(5)8(12)9(16-10)11(14)15-3/h4H,12H2,1-3H3
InChIKeyYLWSLDLOSJQFTR-UHFFFAOYSA-N
XLogP1.81
TPSA78.35 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.23
LogP ≤ 51.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate?
The IUPAC name of methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate (CID 646778) is methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate.
What is the SMILES notation for methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate?
The canonical SMILES for methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate is COC(=O)c1oc2nc(C)cc(C)c2c1N.
What is the InChIKey of methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate?
The InChIKey is YLWSLDLOSJQFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-5-4-6(2)13-10-7(5)8(12)9(16-10)11(14)15-3/h4H,12H2,1-3H3.
What are the key properties of methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate?
methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate has a molecular weight of 220.23 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4,6-dimethylfuro[2,3-b]pyridine-2-carboxylate is sourced from PubChem (CID 646778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).