About N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide
N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide (PubChem CID 6467807) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide |
| PubChem CID | 6467807 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide |
| SMILES | CC1CN(CC(=O)NCc2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C15H22N2O2/c1-12-9-17(10-13(2)19-12)11-15(18)16-8-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H,16,18) |
| InChIKey | RXEVCBLKDZXXRP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide?
The IUPAC name of N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide (CID 6467807) is N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide.
What is the SMILES notation for N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide?
The canonical SMILES for N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide is CC1CN(CC(=O)NCc2ccccc2)CC(C)O1.
What is the InChIKey of N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide?
The InChIKey is RXEVCBLKDZXXRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-12-9-17(10-13(2)19-12)11-15(18)16-8-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H,16,18).
What are the key properties of N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide?
N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide has a molecular weight of 262.35 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(2,6-dimethylmorpholin-4-yl)acetamide is sourced from PubChem (CID 6467807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).