C16H21N3O — CID 64679208
2-(1-aminocyclohexyl)-N-(1H-indol-5-yl)acetamide (PubChem CID 64679208) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(1-aminocyclohexyl)-N-(1H-indol-5-yl)acetamide.
| Compound Name | 2-(1-aminocyclohexyl)-N-(1H-indol-5-yl)acetamide |
|---|---|
| PubChem CID | 64679208 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-(1-aminocyclohexyl)-N-(1H-indol-5-yl)acetamide |
| SMILES | NC1(CC(=O)Nc2ccc3[nH]ccc3c2)CCCCC1 |
| InChI | InChI=1S/C16H21N3O/c17-16(7-2-1-3-8-16)11-15(20)19-13-4-5-14-12(10-13)6-9-18-14/h4-6,9-10,18H,1-3,7-8,11,17H2,(H,19,20) |
| InChIKey | RMYAOXUBZYAJRV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |