About ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate
ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 6468523) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate |
| PubChem CID | 6468523 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)CN2CCCCC2)n1 |
| InChI | InChI=1S/C14H21N3O3S/c1-2-20-13(19)8-11-10-21-14(15-11)16-12(18)9-17-6-4-3-5-7-17/h10H,2-9H2,1H3,(H,15,16,18) |
| InChIKey | JSRFOUZYTVGEDD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate?
The IUPAC name of ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate (CID 6468523) is ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate?
The canonical SMILES for ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate is CCOC(=O)Cc1csc(NC(=O)CN2CCCCC2)n1.
What is the InChIKey of ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate?
The InChIKey is JSRFOUZYTVGEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S/c1-2-20-13(19)8-11-10-21-14(15-11)16-12(18)9-17-6-4-3-5-7-17/h10H,2-9H2,1H3,(H,15,16,18).
What are the key properties of ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate?
ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate has a molecular weight of 311.41 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[(2-piperidin-1-ylacetyl)amino]-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 6468523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).