C11H20N2O2 — CID 6468597
(4-methyl-1,4-diazepan-1-yl)-(oxolan-2-yl)methanone (PubChem CID 6468597) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-(oxolan-2-yl)methanone.
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 6468597 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-(oxolan-2-yl)methanone |
| SMILES | CN1CCCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C11H20N2O2/c1-12-5-3-6-13(8-7-12)11(14)10-4-2-9-15-10/h10H,2-9H2,1H3 |
| InChIKey | IISDLJSOIFVGGZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |