C12H18F3NO2 — CID 64687567
2,2,2-trifluoroethyl 8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 64687567) has the molecular formula C12H18F3NO2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 64687567 |
| Molecular Formula | C12H18F3NO2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OCC(F)(F)F)N1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C12H18F3NO2/c13-12(14,15)9-18-10(17)16-7-5-11(6-8-16)3-1-2-4-11/h1-9H2 |
| InChIKey | XRIRZLPXUMTISA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |