About 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine
5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine (PubChem CID 64687683) has the molecular formula C8H12BrN3S
and a molecular weight of 262.18 g/mol. Its IUPAC name is 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 64687683 |
| Molecular Formula | C8H12BrN3S |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC1(Nc2nnc(Br)s2)CCCC1 |
| InChI | InChI=1S/C8H12BrN3S/c1-8(4-2-3-5-8)10-7-12-11-6(9)13-7/h2-5H2,1H3,(H,10,12) |
| InChIKey | NGSYSTWLQGWQBQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine (CID 64687683) is 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine is CC1(Nc2nnc(Br)s2)CCCC1.
What is the InChIKey of 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine?
The InChIKey is NGSYSTWLQGWQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrN3S/c1-8(4-2-3-5-8)10-7-12-11-6(9)13-7/h2-5H2,1H3,(H,10,12).
What are the key properties of 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine?
5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine has a molecular weight of 262.18 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(1-methylcyclopentyl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 64687683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).