C13H19N — CID 64689567
1-ethyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 64689567) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-ethyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-ethyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 64689567 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-ethyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCC1NCC(C)c2ccc(C)cc21 |
| InChI | InChI=1S/C13H19N/c1-4-13-12-7-9(2)5-6-11(12)10(3)8-14-13/h5-7,10,13-14H,4,8H2,1-3H3 |
| InChIKey | TVURFYUYLQASIG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |