About 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone
2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 6468965) has the molecular formula C14H18ClFN2O2
and a molecular weight of 300.76 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone |
| PubChem CID | 6468965 |
| Molecular Formula | C14H18ClFN2O2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CN1CCCN(C(=O)COc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C14H18ClFN2O2/c1-17-5-2-6-18(8-7-17)14(19)10-20-13-4-3-11(16)9-12(13)15/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | UEJWDUFNBBHDOZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone?
The IUPAC name of 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone (CID 6468965) is 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone.
What is the SMILES notation for 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone?
The canonical SMILES for 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone is CN1CCCN(C(=O)COc2ccc(F)cc2Cl)CC1.
What is the InChIKey of 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone?
The InChIKey is UEJWDUFNBBHDOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClFN2O2/c1-17-5-2-6-18(8-7-17)14(19)10-20-13-4-3-11(16)9-12(13)15/h3-4,9H,2,5-8,10H2,1H3.
What are the key properties of 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone?
2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone has a molecular weight of 300.76 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-4-fluorophenoxy)-1-(4-methyl-1,4-diazepan-1-yl)ethanone is sourced from PubChem (CID 6468965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).