C14H9F2NOS — CID 64689687
2-[(2,4-difluorophenyl)sulfinylmethyl]benzonitrile (PubChem CID 64689687) has the molecular formula C14H9F2NOS and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)sulfinylmethyl]benzonitrile.
| Compound Name | 2-[(2,4-difluorophenyl)sulfinylmethyl]benzonitrile |
|---|---|
| PubChem CID | 64689687 |
| Molecular Formula | C14H9F2NOS |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[(2,4-difluorophenyl)sulfinylmethyl]benzonitrile |
| SMILES | N#Cc1ccccc1CS(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H9F2NOS/c15-12-5-6-14(13(16)7-12)19(18)9-11-4-2-1-3-10(11)8-17/h1-7H,9H2 |
| InChIKey | QFBSCSMEAUPUJT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |