C13H17N3O3 — CID 64689906
6-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-3-amine (PubChem CID 64689906) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 6-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-3-amine.
| Compound Name | 6-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-3-amine |
|---|---|
| PubChem CID | 64689906 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-3-amine |
| SMILES | COc1cc(C2=NN=C(N)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C13H17N3O3/c1-17-10-6-8(7-11(18-2)13(10)19-3)9-4-5-12(14)16-15-9/h6-7H,4-5H2,1-3H3,(H2,14,16) |
| InChIKey | PZLAWRJEIAZKHX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |