About N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide
N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 6469181) has the molecular formula C14H19FN2O
and a molecular weight of 250.32 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide |
| PubChem CID | 6469181 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)Nc2ccccc2F)C1 |
| InChI | InChI=1S/C14H19FN2O/c1-10-7-11(2)9-17(8-10)14(18)16-13-6-4-3-5-12(13)15/h3-6,10-11H,7-9H2,1-2H3,(H,16,18) |
| InChIKey | MLSCDEKVQLXLII-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide?
The IUPAC name of N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide (CID 6469181) is N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide.
What is the SMILES notation for N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide?
The canonical SMILES for N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide is CC1CC(C)CN(C(=O)Nc2ccccc2F)C1.
What is the InChIKey of N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide?
The InChIKey is MLSCDEKVQLXLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2O/c1-10-7-11(2)9-17(8-10)14(18)16-13-6-4-3-5-12(13)15/h3-6,10-11H,7-9H2,1-2H3,(H,16,18).
What are the key properties of N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide?
N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide has a molecular weight of 250.32 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide is sourced from PubChem (CID 6469181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).