C17H21NO — CID 64693312
1-[(2-ethylphenyl)methyl]-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 64693312) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-[(2-ethylphenyl)methyl]-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-[(2-ethylphenyl)methyl]-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 64693312 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-[(2-ethylphenyl)methyl]-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | CCc1ccccc1Cn1ccc2c1CCCC2O |
| InChI | InChI=1S/C17H21NO/c1-2-13-6-3-4-7-14(13)12-18-11-10-15-16(18)8-5-9-17(15)19/h3-4,6-7,10-11,17,19H,2,5,8-9,12H2,1H3 |
| InChIKey | YGAOKFALNJYGHB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |