C22H19F3N4O4 — CID 646939
5-(1,3-benzodioxol-5-yl)-N-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 646939) has the molecular formula C22H19F3N4O4 and a molecular weight of 460.41 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 646939 |
| Molecular Formula | C22H19F3N4O4 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2n(n1)C(C(F)(F)F)CC(c1ccc3c(c1)OCO3)N2 |
| InChI | InChI=1S/C22H19F3N4O4/c1-31-16-5-3-2-4-13(16)27-21(30)15-10-20-26-14(9-19(22(23,24)25)29(20)28-15)12-6-7-17-18(8-12)33-11-32-17/h2-8,10,14,19,26H,9,11H2,1H3,(H,27,30) |
| InChIKey | KJJZKWOUHLHRIM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |