About N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide
N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide (PubChem CID 646944) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide |
| PubChem CID | 646944 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(=O)N(CCO)Cc1cc2cc(C)cc(C)c2[nH]c1=O |
| InChI | InChI=1S/C16H20N2O3/c1-10-6-11(2)15-13(7-10)8-14(16(21)17-15)9-18(4-5-19)12(3)20/h6-8,19H,4-5,9H2,1-3H3,(H,17,21) |
| InChIKey | UCHHZCZZHYQESC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide?
The IUPAC name of N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide (CID 646944) is N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide.
What is the SMILES notation for N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide?
The canonical SMILES for N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide is CC(=O)N(CCO)Cc1cc2cc(C)cc(C)c2[nH]c1=O.
What is the InChIKey of N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide?
The InChIKey is UCHHZCZZHYQESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-10-6-11(2)15-13(7-10)8-14(16(21)17-15)9-18(4-5-19)12(3)20/h6-8,19H,4-5,9H2,1-3H3,(H,17,21).
What are the key properties of N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide?
N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide has a molecular weight of 288.35 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)acetamide is sourced from PubChem (CID 646944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).